Products 108540-27-8

CAS 108540-27-8 is the registry number for H-Val-Lys-OH monoacetate salt. Offered by: Biosynth. Available pack sizes: 50mg.

Structural formula: {0} (CAS {1})

Acetic acid;(2S)-6-amino-2-[[(2S)-2-amino-3-methylbutanoyl]amino]hexanoic acid (CAS 108540-27-8) is a chemical compound with the molecular formula C13H27N3O5 and a molecular weight of 305.37 g/mol. IUPAC name: acetic acid;(2S)-6-amino-2-[[(2S)-2-amino-3-methylbutanoyl]amino]hexanoic acid. InChIKey: BDOUMLNRBPRMHS-OZZZDHQUSA-N.

Identity
Molecular formulaC13H27N3O5
Molecular weight305.37 g/mol
IUPAC nameacetic acid;(2S)-6-amino-2-[[(2S)-2-amino-3-methylbutanoyl]amino]hexanoic acid
InChIKeyBDOUMLNRBPRMHS-OZZZDHQUSA-N
SMILESCC(C)[C@@H](C(=O)N[C@@H](CCCCN)C(=O)O)N.CC(=O)O

Computed by PubChem (NCBI)