CAS 108540-27-8 is the registry number for H-Val-Lys-OH monoacetate salt. Offered by: Biosynth. Available pack sizes: 50mg.
Acetic acid;(2S)-6-amino-2-[[(2S)-2-amino-3-methylbutanoyl]amino]hexanoic acid (CAS 108540-27-8) is a chemical compound with the molecular formula C13H27N3O5 and a molecular weight of 305.37 g/mol. IUPAC name: acetic acid;(2S)-6-amino-2-[[(2S)-2-amino-3-methylbutanoyl]amino]hexanoic acid. InChIKey: BDOUMLNRBPRMHS-OZZZDHQUSA-N.
| Molecular formula | C13H27N3O5 |
|---|---|
| Molecular weight | 305.37 g/mol |
| IUPAC name | acetic acid;(2S)-6-amino-2-[[(2S)-2-amino-3-methylbutanoyl]amino]hexanoic acid |
| InChIKey | BDOUMLNRBPRMHS-OZZZDHQUSA-N |
| SMILES | CC(C)[C@@H](C(=O)N[C@@H](CCCCN)C(=O)O)N.CC(=O)O |
Computed by PubChem (NCBI)