Products 108544-97-4

CAS 108544-97-4 appears in our catalog under these names: 5,6-Dichloro-4-hydroxy-3-methoxybenzoic acid, 95%, 5,6-Dichlorovanillic acid. Offered by: Combi-blocks, Biosynth. Available pack sizes: 100mg, 1g, 250mg, 1000mg, 500mg, 2000mg, 5000mg, 10000mg.

Structural formula: {0} (CAS {1})

2,3-dichloro-4-hydroxy-5-methoxybenzoic acid (CAS 108544-97-4) is a chemical compound with the molecular formula C8H6Cl2O4 and a molecular weight of 237.03 g/mol. IUPAC name: 2,3-dichloro-4-hydroxy-5-methoxybenzoic acid. InChIKey: PIUZBDHQOOFIPU-UHFFFAOYSA-N.

Identity
Molecular formulaC8H6Cl2O4
Molecular weight237.03 g/mol
IUPAC name2,3-dichloro-4-hydroxy-5-methoxybenzoic acid
InChIKeyPIUZBDHQOOFIPU-UHFFFAOYSA-N
SMILESCOC1=C(C(=C(C(=C1)C(=O)O)Cl)Cl)O

Computed by PubChem (NCBI)