CAS 1085528-20-6 is the registry number for (2R)–2–((Methoxycarbonyl)(methyl)amino)propanoic acid. Offered by: GLPBio. Available pack sizes: 10g, 5g.
(2R)-2-[methoxycarbonyl(methyl)amino]propanoic acid (CAS 1085528-20-6) is a chemical compound with the molecular formula C6H11NO4 and a molecular weight of 161.16 g/mol. IUPAC name: (2R)-2-[methoxycarbonyl(methyl)amino]propanoic acid. InChIKey: LMUVIOBZBRHXMY-SCSAIBSYSA-N.
| Molecular formula | C6H11NO4 |
|---|---|
| Molecular weight | 161.16 g/mol |
| IUPAC name | (2R)-2-[methoxycarbonyl(methyl)amino]propanoic acid |
| InChIKey | LMUVIOBZBRHXMY-SCSAIBSYSA-N |
| SMILES | C[C@H](C(=O)O)N(C)C(=O)OC |
Computed by PubChem (NCBI)