CAS 108562-21-6 is the registry number for 1-Isocyanatopyrene, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.
1-isocyanatopyrene (CAS 108562-21-6) is a chemical compound with the molecular formula C17H9NO and a molecular weight of 243.26 g/mol. IUPAC name: 1-isocyanatopyrene. InChIKey: ORMKUBWIWXXRRL-UHFFFAOYSA-N.
| Molecular formula | C17H9NO |
|---|---|
| Molecular weight | 243.26 g/mol |
| IUPAC name | 1-isocyanatopyrene |
| InChIKey | ORMKUBWIWXXRRL-UHFFFAOYSA-N |
| SMILES | C1=CC2=C3C(=C1)C=CC4=C(C=CC(=C43)C=C2)N=C=O |
Computed by PubChem (NCBI)