CAS 1086-00-6 appears in our catalog under these names: 1-Chloromethylpyrene, 95%, 1–Chloromethylpyrene, 1-Chloromethylpyrene, >97.0%(T), 1-Chloromethylpyrene, 98%, 98%, 1-Chloromethylpyrene, 98.0%. Offered by: Combi-blocks, GLPBio, TCI, Chemat, MedChemExpress. Available pack sizes: 250mg, 1g, 200mg, 100mg, 5 g, 250 mg, 100 mg, 1 g.
1-(chloromethyl)pyrene (CAS 1086-00-6) is a chemical compound with the molecular formula C17H11Cl and a molecular weight of 250.7 g/mol. IUPAC name: 1-(chloromethyl)pyrene. InChIKey: MVNXSXOJYGSNQZ-UHFFFAOYSA-N.
| Molecular formula | C17H11Cl |
|---|---|
| Molecular weight | 250.7 g/mol |
| IUPAC name | 1-(chloromethyl)pyrene |
| InChIKey | MVNXSXOJYGSNQZ-UHFFFAOYSA-N |
| SMILES | C1=CC2=C3C(=C1)C=CC4=C(C=CC(=C43)C=C2)CCl |
Computed by PubChem (NCBI)