CAS 1086096-26-5 appears in our catalog under these names: Sodium Decanoate-d19, 98 atom % D, min 98% Chemical Purity, Decanoic acid-d19 (sodium). Offered by: CDN, MedChemExpress. Available pack sizes: 0,5g, 0,25g, 50 mg, 25 mg, 100 mg.
Sodium 2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-nonadecadeuteriodecanoate (CAS 1086096-26-5) is a chemical compound with the molecular formula C10H19NaO2 and a molecular weight of 213.36 g/mol. IUPAC name: sodium 2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-nonadecadeuteriodecanoate. InChIKey: FIWQZURFGYXCEO-SIEBOIPHSA-M.
| Molecular formula | C10H19NaO2 |
|---|---|
| Molecular weight | 213.36 g/mol |
| IUPAC name | sodium 2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-nonadecadeuteriodecanoate |
| InChIKey | FIWQZURFGYXCEO-SIEBOIPHSA-M |
| SMILES | [2H]C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C(=O)[O-].[Na+] |
Computed by PubChem (NCBI)