Products 108635-83-2

CAS 108635-83-2 appears in our catalog under these names: Mizolastine Impurity 2, Mizolastine Impurity 1, Mizolastine Impurity 3. Offered by: Chemat Brand, Hubei YoungXin. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg.

1-[1-[(4-fluorophenyl)methyl]benzimidazol-2-yl]-N-methylpiperidin-4-amine (CAS 108635-83-2) is a chemical compound with the molecular formula C20H23FN4 and a molecular weight of 338.4 g/mol. IUPAC name: 1-[1-[(4-fluorophenyl)methyl]benzimidazol-2-yl]-N-methylpiperidin-4-amine. InChIKey: LDMXQNXCFMLIER-UHFFFAOYSA-N.

Identity
Molecular formulaC20H23FN4
Molecular weight338.4 g/mol
IUPAC name1-[1-[(4-fluorophenyl)methyl]benzimidazol-2-yl]-N-methylpiperidin-4-amine
InChIKeyLDMXQNXCFMLIER-UHFFFAOYSA-N
SMILESCNC1CCN(CC1)C2=NC3=CC=CC=C3N2CC4=CC=C(C=C4)F

Computed by PubChem (NCBI)