CAS 1086380-23-5 appears in our catalog under these names: 2-Amino-5-(trifluoromethyl)-4-thiazolecarboxylic Acid, 2-Amino-5-(trifluoromethyl)thiazole-4-carboxylic acid, 95+%. Offered by: TRC, Biosynth, AmBeed. Available pack sizes: 250mg, 0,5g, 0,25g, 1g, 2g, 5g.
2-amino-5-(trifluoromethyl)-1,3-thiazole-4-carboxylic acid (CAS 1086380-23-5) is a chemical compound with the molecular formula C5H3F3N2O2S and a molecular weight of 212.15 g/mol. IUPAC name: 2-amino-5-(trifluoromethyl)-1,3-thiazole-4-carboxylic acid. InChIKey: WKLMMGOQPSMWRH-UHFFFAOYSA-N.
| Molecular formula | C5H3F3N2O2S |
|---|---|
| Molecular weight | 212.15 g/mol |
| IUPAC name | 2-amino-5-(trifluoromethyl)-1,3-thiazole-4-carboxylic acid |
| InChIKey | WKLMMGOQPSMWRH-UHFFFAOYSA-N |
| SMILES | C1(=C(SC(=N1)N)C(F)(F)F)C(=O)O |
Computed by PubChem (NCBI)