CAS 108739-88-4 is the registry number for 2,3,4,6-Tetra-O-acetyl-b-D-galactopyranosyl formamide. Offered by: Biosynth. Available pack sizes: 5g, 1g, 10g.
[(2R,3S,4S,5R,6R)-3,4,5-triacetyloxy-6-carbamoyloxan-2-yl]methyl acetate (CAS 108739-88-4) is a chemical compound with the molecular formula C15H21NO10 and a molecular weight of 375.33 g/mol. IUPAC name: [(2R,3S,4S,5R,6R)-3,4,5-triacetyloxy-6-carbamoyloxan-2-yl]methyl acetate. InChIKey: HCTJYUJESYMOGS-MBJXGIAVSA-N.
| Molecular formula | C15H21NO10 |
|---|---|
| Molecular weight | 375.33 g/mol |
| IUPAC name | [(2R,3S,4S,5R,6R)-3,4,5-triacetyloxy-6-carbamoyloxan-2-yl]methyl acetate |
| InChIKey | HCTJYUJESYMOGS-MBJXGIAVSA-N |
| SMILES | CC(=O)OC[C@@H]1[C@@H]([C@@H]([C@H]([C@@H](O1)C(=O)N)OC(=O)C)OC(=O)C)OC(=O)C |
Computed by PubChem (NCBI)