Products 1087725-58-3
CAS 1087725-58-3 appears in our catalog under these names: 2-(3-Nitrophenyl)hexahydro-1,3-benzodioxole, 95%, 2-(3-Nitrophenyl)hexahydrobenzo(d)(1,3)dioxole, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g.
2-(3-nitrophenyl)-3a,4,5,6,7,7a-hexahydro-1,3-benzodioxole (CAS 1087725-58-3) is a chemical compound with the molecular formula C13H15NO4 and a molecular weight of 249.26 g/mol. IUPAC name: 2-(3-nitrophenyl)-3a,4,5,6,7,7a-hexahydro-1,3-benzodioxole. InChIKey: FBLGHFGQOUTXPP-UHFFFAOYSA-N.
| Molecular formula | C13H15NO4 |
|---|---|
| Molecular weight | 249.26 g/mol |
| IUPAC name | 2-(3-nitrophenyl)-3a,4,5,6,7,7a-hexahydro-1,3-benzodioxole |
| InChIKey | FBLGHFGQOUTXPP-UHFFFAOYSA-N |
| SMILES | C1CCC2C(C1)OC(O2)C3=CC(=CC=C3)[N+](=O)[O-] |
Computed by PubChem (NCBI)