CAS 1087787-44-7 is the registry number for N-(2-Bromophenyl)-2,2,2-trifluoroacetimidoyl chloride, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
N-(2-bromophenyl)-2,2,2-trifluoroethanimidoyl chloride (CAS 1087787-44-7) is a chemical compound with the molecular formula C8H4BrClF3N and a molecular weight of 286.47 g/mol. IUPAC name: N-(2-bromophenyl)-2,2,2-trifluoroethanimidoyl chloride. InChIKey: YOLUCAAEVNUSQU-UHFFFAOYSA-N.
| Molecular formula | C8H4BrClF3N |
|---|---|
| Molecular weight | 286.47 g/mol |
| IUPAC name | N-(2-bromophenyl)-2,2,2-trifluoroethanimidoyl chloride |
| InChIKey | YOLUCAAEVNUSQU-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)N=C(C(F)(F)F)Cl)Br |
Computed by PubChem (NCBI)