Products 1087787-44-7

CAS 1087787-44-7 is the registry number for N-(2-Bromophenyl)-2,2,2-trifluoroacetimidoyl chloride, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

N-(2-bromophenyl)-2,2,2-trifluoroethanimidoyl chloride (CAS 1087787-44-7) is a chemical compound with the molecular formula C8H4BrClF3N and a molecular weight of 286.47 g/mol. IUPAC name: N-(2-bromophenyl)-2,2,2-trifluoroethanimidoyl chloride. InChIKey: YOLUCAAEVNUSQU-UHFFFAOYSA-N.

Identity
Molecular formulaC8H4BrClF3N
Molecular weight286.47 g/mol
IUPAC nameN-(2-bromophenyl)-2,2,2-trifluoroethanimidoyl chloride
InChIKeyYOLUCAAEVNUSQU-UHFFFAOYSA-N
SMILESC1=CC=C(C(=C1)N=C(C(F)(F)F)Cl)Br

Computed by PubChem (NCBI)