Products 1087788-91-7
CAS 1087788-91-7 appears in our catalog under these names: 2,2,2-Trifluoroethyl N-(5-chloro-2-methoxyphenyl)carbamate, 95%, 2,2,2-Trifluoroethyl N-(5-chloro-2-methoxyphenyl)carbamate. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 1g, 100mg.
2,2,2-trifluoroethyl N-(5-chloro-2-methoxyphenyl)carbamate (CAS 1087788-91-7) is a chemical compound with the molecular formula C10H9ClF3NO3 and a molecular weight of 283.63 g/mol. IUPAC name: 2,2,2-trifluoroethyl N-(5-chloro-2-methoxyphenyl)carbamate. InChIKey: JBBBYBCFKMXAFD-UHFFFAOYSA-N.
| Molecular formula | C10H9ClF3NO3 |
|---|---|
| Molecular weight | 283.63 g/mol |
| IUPAC name | 2,2,2-trifluoroethyl N-(5-chloro-2-methoxyphenyl)carbamate |
| InChIKey | JBBBYBCFKMXAFD-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C=C1)Cl)NC(=O)OCC(F)(F)F |
Computed by PubChem (NCBI)