CAS 1087789-13-6 appears in our catalog under these names: tert-Butyl 4-(iodomethyl)-2,2-dimethyl-1,3-oxazolidine-3-carboxylate, 95%, tert-Butyl 4-(iodomethyl)-2,2-dimethyl-1,3-oxazolidine-3-carboxylate. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 1g, 100mg.
Tert-butyl 4-(iodomethyl)-2,2-dimethyl-1,3-oxazolidine-3-carboxylate (CAS 1087789-13-6) is a chemical compound with the molecular formula C11H20INO3 and a molecular weight of 341.19 g/mol. IUPAC name: tert-butyl 4-(iodomethyl)-2,2-dimethyl-1,3-oxazolidine-3-carboxylate. InChIKey: RAGBRZVZDZOFAI-UHFFFAOYSA-N.
| Molecular formula | C11H20INO3 |
|---|---|
| Molecular weight | 341.19 g/mol |
| IUPAC name | tert-butyl 4-(iodomethyl)-2,2-dimethyl-1,3-oxazolidine-3-carboxylate |
| InChIKey | RAGBRZVZDZOFAI-UHFFFAOYSA-N |
| SMILES | CC1(N(C(CO1)CI)C(=O)OC(C)(C)C)C |
Computed by PubChem (NCBI)