CAS 108779-46-0 appears in our catalog under these names: Aristolochic acid Va, Aristolochic acid Va, ≥98%, ≥98%, Aristolochic acid Va, 98.74%. Offered by: GLPBio, Chemat, MedChemExpress. Available pack sizes: 5mg, 5 mg, 1 mg.
10-hydroxy-9-methoxy-6-nitronaphtho[2,1-g][1,3]benzodioxole-5-carboxylic acid (CAS 108779-46-0) is a chemical compound with the molecular formula C17H11NO8 and a molecular weight of 357.3 g/mol. IUPAC name: 10-hydroxy-9-methoxy-6-nitronaphtho[2,1-g][1,3]benzodioxole-5-carboxylic acid. InChIKey: FAOPQZPNWIPJKI-UHFFFAOYSA-N.
| Molecular formula | C17H11NO8 |
|---|---|
| Molecular weight | 357.3 g/mol |
| IUPAC name | 10-hydroxy-9-methoxy-6-nitronaphtho[2,1-g][1,3]benzodioxole-5-carboxylic acid |
| InChIKey | FAOPQZPNWIPJKI-UHFFFAOYSA-N |
| SMILES | COC1=CC2=CC(=C3C(=CC4=C(C3=C2C=C1O)OCO4)C(=O)O)[N+](=O)[O-] |
Computed by PubChem (NCBI)