CAS 108807-66-5 is the registry number for H-L-Cys(Npys)-OH*HCl. Offered by: Iris Biotech. Available pack sizes: 1g, 5g.
(2R)-2-amino-3-[(3-nitro-2-pyridinyl)disulfanyl]propanoic acid;hydrochloride (CAS 108807-66-5) is a chemical compound with the molecular formula C8H10ClN3O4S2 and a molecular weight of 311.8 g/mol. IUPAC name: (2R)-2-amino-3-[(3-nitro-2-pyridinyl)disulfanyl]propanoic acid;hydrochloride. InChIKey: CWMGAPUFRGBKNZ-JEDNCBNOSA-N.
| Molecular formula | C8H10ClN3O4S2 |
|---|---|
| Molecular weight | 311.8 g/mol |
| IUPAC name | (2R)-2-amino-3-[(3-nitro-2-pyridinyl)disulfanyl]propanoic acid;hydrochloride |
| InChIKey | CWMGAPUFRGBKNZ-JEDNCBNOSA-N |
| SMILES | C1=CC(=C(N=C1)SSC[C@@H](C(=O)O)N)[N+](=O)[O-].Cl |
Computed by PubChem (NCBI)