Products 108852-42-2
CAS 108852-42-2 appears in our catalog under these names: YS–201, YS-201, YS-201, 99%, 99%, YS-201, 99.70%, YS-201, 99%. Offered by: GLPBio, Biosynth, Chemat, MedChemExpress, Ambeed. Available pack sizes: 1mg, 10mg, 20mg, 5mg, 25mg, 50mg, 100mg, 20 mg.
3-O-ethyl 5-O-(2-piperidin-1-ylethyl) 2,6-dimethyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate (CAS 108852-42-2) is a chemical compound with the molecular formula C24H31N3O6 and a molecular weight of 457.5 g/mol. IUPAC name: 3-O-ethyl 5-O-(2-piperidin-1-ylethyl) 2,6-dimethyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate. InChIKey: LBSRZVRITCRLIU-UHFFFAOYSA-N.
| Molecular formula | C24H31N3O6 |
|---|---|
| Molecular weight | 457.5 g/mol |
| IUPAC name | 3-O-ethyl 5-O-(2-piperidin-1-ylethyl) 2,6-dimethyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate |
| InChIKey | LBSRZVRITCRLIU-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(NC(=C(C1C2=CC(=CC=C2)[N+](=O)[O-])C(=O)OCCN3CCCCC3)C)C |
Computed by PubChem (NCBI)