CAS 108864-61-5 is the registry number for (5S)-Neosamine C. Offered by: MedChemExpress. Available pack sizes: Get quote.
(3R,4R,5S,6R)-3-amino-6-(aminomethyl)oxane-2,4,5-triol (CAS 108864-61-5) is a chemical compound with the molecular formula C6H14N2O4 and a molecular weight of 178.19 g/mol. IUPAC name: (3R,4R,5S,6R)-3-amino-6-(aminomethyl)oxane-2,4,5-triol. InChIKey: SQTHUUHOUPJYLK-IVMDWMLBSA-N.
| Molecular formula | C6H14N2O4 |
|---|---|
| Molecular weight | 178.19 g/mol |
| IUPAC name | (3R,4R,5S,6R)-3-amino-6-(aminomethyl)oxane-2,4,5-triol |
| InChIKey | SQTHUUHOUPJYLK-IVMDWMLBSA-N |
| SMILES | C([C@@H]1[C@H]([C@@H]([C@H](C(O1)O)N)O)O)N |
Computed by PubChem (NCBI)