CAS 108865-78-7 is the registry number for (2S, 3R)-3-Amino-2-oxetanecarboxylic acid. Offered by: Biosynth. Available pack sizes: 1000mg, 500mg.
(2S,3R)-3-aminooxetane-2-carboxylic acid (CAS 108865-78-7) is a chemical compound with the molecular formula C4H7NO3 and a molecular weight of 117.10 g/mol. IUPAC name: (2S,3R)-3-aminooxetane-2-carboxylic acid. InChIKey: UTIYGJDWWLIDQY-GBXIJSLDSA-N.
| Molecular formula | C4H7NO3 |
|---|---|
| Molecular weight | 117.10 g/mol |
| IUPAC name | (2S,3R)-3-aminooxetane-2-carboxylic acid |
| InChIKey | UTIYGJDWWLIDQY-GBXIJSLDSA-N |
| SMILES | C1[C@H]([C@H](O1)C(=O)O)N |
Computed by PubChem (NCBI)