CAS 108884-00-0 is the registry number for o-Coumaric Acid 4-O-beta-D-Glucuronide. Offered by: TRC. Available pack sizes: 100mg.
(2S,3S,4S,5R,6S)-6-[2-[(E)-2-carboxyethenyl]phenoxy]-3,4,5-trihydroxyoxane-2-carboxylic acid (CAS 108884-00-0) is a chemical compound with the molecular formula C15H16O9 and a molecular weight of 340.28 g/mol. IUPAC name: (2S,3S,4S,5R,6S)-6-[2-[(E)-2-carboxyethenyl]phenoxy]-3,4,5-trihydroxyoxane-2-carboxylic acid. InChIKey: KRKMNGLGYXJMBZ-YLOLIOOTSA-N.
| Molecular formula | C15H16O9 |
|---|---|
| Molecular weight | 340.28 g/mol |
| IUPAC name | (2S,3S,4S,5R,6S)-6-[2-[(E)-2-carboxyethenyl]phenoxy]-3,4,5-trihydroxyoxane-2-carboxylic acid |
| InChIKey | KRKMNGLGYXJMBZ-YLOLIOOTSA-N |
| SMILES | C1=CC=C(C(=C1)/C=C/C(=O)O)O[C@H]2[C@@H]([C@H]([C@@H]([C@H](O2)C(=O)O)O)O)O |
Computed by PubChem (NCBI)