Products 1088991-73-4
CAS 1088991-73-4 appears in our catalog under these names: Filorexant, 95%, Filorexant, 98+%, Filorexant/ 99.33% (existing batch purity), MK 6096, Mk-6096. Offered by: Combi-blocks, AmBeed, TargetMol, GLPBio, Chemat. Available pack sizes: 100mg, 1mg, 5mg, 10mg, 25mg, 50mg, 2mg, 10mM (in 1ml dmso).
[(2R,5R)-5-[(5-fluoro-2-pyridinyl)oxymethyl]-2-methylpiperidin-1-yl]-(5-methyl-2-pyrimidin-2-ylphenyl)methanone (CAS 1088991-73-4) is a chemical compound with the molecular formula C24H25FN4O2 and a molecular weight of 420.5 g/mol. IUPAC name: [(2R,5R)-5-[(5-fluoro-2-pyridinyl)oxymethyl]-2-methylpiperidin-1-yl]-(5-methyl-2-pyrimidin-2-ylphenyl)methanone. InChIKey: NPFDWHQSDBWQLH-QZTJIDSGSA-N.
| Molecular formula | C24H25FN4O2 |
|---|---|
| Molecular weight | 420.5 g/mol |
| IUPAC name | [(2R,5R)-5-[(5-fluoro-2-pyridinyl)oxymethyl]-2-methylpiperidin-1-yl]-(5-methyl-2-pyrimidin-2-ylphenyl)methanone |
| InChIKey | NPFDWHQSDBWQLH-QZTJIDSGSA-N |
| SMILES | C[C@@H]1CC[C@H](CN1C(=O)C2=C(C=CC(=C2)C)C3=NC=CC=N3)COC4=NC=C(C=C4)F |
Computed by PubChem (NCBI)