CAS 1089-77-6 appears in our catalog under these names: P,P'-Diphenylethylenediphosphinic Acid, Ethane–1,2–diylbis(phenylphosphinic acid), Ethane-1,2-diylbis(phenylphosphinic acid) 95%. Offered by: TRC, GLPBio, Biosynth, Ambeed. Available pack sizes: 100mg, 50mg, 250mg, 1g.
2-[hydroxy(phenyl)phosphoryl]ethyl-phenylphosphinic acid (CAS 1089-77-6) is a chemical compound with the molecular formula C14H16O4P2 and a molecular weight of 310.22 g/mol. IUPAC name: 2-[hydroxy(phenyl)phosphoryl]ethyl-phenylphosphinic acid. InChIKey: FYLYSEXHKNLCOF-UHFFFAOYSA-N.
| Molecular formula | C14H16O4P2 |
|---|---|
| Molecular weight | 310.22 g/mol |
| IUPAC name | 2-[hydroxy(phenyl)phosphoryl]ethyl-phenylphosphinic acid |
| InChIKey | FYLYSEXHKNLCOF-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)P(=O)(CCP(=O)(C2=CC=CC=C2)O)O |
Computed by PubChem (NCBI)