CAS 1089332-30-8 is the registry number for 3-(4-Chloro-3,8-dimethyl-1H-pyrazolo[3,4-b]quinolin-1-yl)tetrahydrothiophene 1,1-dioxide, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
3-(4-chloro-3,8-dimethylpyrazolo[3,4-b]quinolin-1-yl)thiolane 1,1-dioxide (CAS 1089332-30-8) is a chemical compound with the molecular formula C16H16ClN3O2S and a molecular weight of 349.8 g/mol. IUPAC name: 3-(4-chloro-3,8-dimethylpyrazolo[3,4-b]quinolin-1-yl)thiolane 1,1-dioxide. InChIKey: KWPRUUJMMFNUSF-UHFFFAOYSA-N.
| Molecular formula | C16H16ClN3O2S |
|---|---|
| Molecular weight | 349.8 g/mol |
| IUPAC name | 3-(4-chloro-3,8-dimethylpyrazolo[3,4-b]quinolin-1-yl)thiolane 1,1-dioxide |
| InChIKey | KWPRUUJMMFNUSF-UHFFFAOYSA-N |
| SMILES | CC1=C2C(=CC=C1)C(=C3C(=NN(C3=N2)C4CCS(=O)(=O)C4)C)Cl |
Computed by PubChem (NCBI)