Products 503132-29-4
CAS 503132-29-4 is the registry number for 4-(((4-chlorophenyl)amino)thioxomethyl)piperazinyl 2-furyl ketone. Offered by: Biosynth. Available pack sizes: 250mg.
N-(4-chlorophenyl)-4-(furan-2-carbonyl)piperazine-1-carbothioamide (CAS 503132-29-4) is a chemical compound with the molecular formula C16H16ClN3O2S and a molecular weight of 349.8 g/mol. IUPAC name: N-(4-chlorophenyl)-4-(furan-2-carbonyl)piperazine-1-carbothioamide. InChIKey: OVZSWJHRQDXOED-UHFFFAOYSA-N.
| Molecular formula | C16H16ClN3O2S |
|---|---|
| Molecular weight | 349.8 g/mol |
| IUPAC name | N-(4-chlorophenyl)-4-(furan-2-carbonyl)piperazine-1-carbothioamide |
| InChIKey | OVZSWJHRQDXOED-UHFFFAOYSA-N |
| SMILES | C1CN(CCN1C(=O)C2=CC=CO2)C(=S)NC3=CC=C(C=C3)Cl |
Computed by PubChem (NCBI)