CAS 1089345-78-7 is the registry number for 1-(2,2-Difluorobenzo[d][1,3]dioxol-5-yl)ethane-1,2-diamine, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
1-(2,2-difluoro-1,3-benzodioxol-5-yl)ethane-1,2-diamine (CAS 1089345-78-7) is a chemical compound with the molecular formula C9H10F2N2O2 and a molecular weight of 216.18 g/mol. IUPAC name: 1-(2,2-difluoro-1,3-benzodioxol-5-yl)ethane-1,2-diamine. InChIKey: YSUUJFAMBVQLEW-UHFFFAOYSA-N.
| Molecular formula | C9H10F2N2O2 |
|---|---|
| Molecular weight | 216.18 g/mol |
| IUPAC name | 1-(2,2-difluoro-1,3-benzodioxol-5-yl)ethane-1,2-diamine |
| InChIKey | YSUUJFAMBVQLEW-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1C(CN)N)OC(O2)(F)F |
Computed by PubChem (NCBI)