CAS 108963-16-2 appears in our catalog under these names: 1,4-bis(methanesulfonyloxy)butan-2-yl methanesulfonate, 95%, 1,2,4–Tris(methanesulfonyloxy)butane, 1,2,4-Tris(methanesulfonyloxy)butane, 1,2,4-Tris(methanesulfonyloxy)butane. Offered by: Combi-blocks, GLPBio, Biosynth, TCI, Chemat. Available pack sizes: 1g, 5g, 25g.
3,4-bis(methylsulfonyloxy)butyl methanesulfonate (CAS 108963-16-2) is a chemical compound with the molecular formula C7H16O9S3 and a molecular weight of 340.4 g/mol. IUPAC name: 3,4-bis(methylsulfonyloxy)butyl methanesulfonate. InChIKey: YJIUOKPKBPEIMF-UHFFFAOYSA-N.
| Molecular formula | C7H16O9S3 |
|---|---|
| Molecular weight | 340.4 g/mol |
| IUPAC name | 3,4-bis(methylsulfonyloxy)butyl methanesulfonate |
| InChIKey | YJIUOKPKBPEIMF-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)OCCC(COS(=O)(=O)C)OS(=O)(=O)C |
Computed by PubChem (NCBI)