CAS 108983-83-1 appears in our catalog under these names: 2-(4-Benzhydrylpiperazin-1-yl)ethan-1-ol Dihydrochloride, 4-(Diphenylmethyl)-1-piperazineethanol dihydrochloride, 95%, 4-(Diphenylmethyl)-1-piperazineethanol dihydrochloride, 96%, 4-Benzhydryl-1-piperazineethanol Dihydrochloride, >95% (HPLC), 4-(Diphenylmethyl)-1-piperazineethanol dihydrochloride, 95%, 95%. Offered by: Mikromol, Combi-blocks, Fluorochem, TRC, Chemat. Available pack sizes: 25mg, 250mg, 1g, 100mg, 10mg, on request, Get quote.
2-(4-benzhydrylpiperazin-1-yl)ethanol;dihydrochloride (CAS 108983-83-1) is a chemical compound with the molecular formula C19H26Cl2N2O and a molecular weight of 369.3 g/mol. IUPAC name: 2-(4-benzhydrylpiperazin-1-yl)ethanol;dihydrochloride. InChIKey: DJRDCMNGICGKGJ-UHFFFAOYSA-N.
| Molecular formula | C19H26Cl2N2O |
|---|---|
| Molecular weight | 369.3 g/mol |
| IUPAC name | 2-(4-benzhydrylpiperazin-1-yl)ethanol;dihydrochloride |
| InChIKey | DJRDCMNGICGKGJ-UHFFFAOYSA-N |
| SMILES | C1CN(CCN1CCO)C(C2=CC=CC=C2)C3=CC=CC=C3.Cl.Cl |
Computed by PubChem (NCBI)