Products 1090033-18-3
CAS 1090033-18-3 is the registry number for 2-(tert-Butylamino)-N-(3,5-difluorophenyl)acetamide, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-(tert-butylamino)-N-(3,5-difluorophenyl)acetamide (CAS 1090033-18-3) is a chemical compound with the molecular formula C12H16F2N2O and a molecular weight of 242.26 g/mol. IUPAC name: 2-(tert-butylamino)-N-(3,5-difluorophenyl)acetamide. InChIKey: LAIMSMPIXDBGSJ-UHFFFAOYSA-N.
| Molecular formula | C12H16F2N2O |
|---|---|
| Molecular weight | 242.26 g/mol |
| IUPAC name | 2-(tert-butylamino)-N-(3,5-difluorophenyl)acetamide |
| InChIKey | LAIMSMPIXDBGSJ-UHFFFAOYSA-N |
| SMILES | CC(C)(C)NCC(=O)NC1=CC(=CC(=C1)F)F |
Computed by PubChem (NCBI)