CAS 1090889-86-3 is the registry number for N-Isopropyl-2,5-dimethylthiophene-3-carboxamide, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
2,5-dimethyl-N-propan-2-ylthiophene-3-carboxamide (CAS 1090889-86-3) is a chemical compound with the molecular formula C10H15NOS and a molecular weight of 197.30 g/mol. IUPAC name: 2,5-dimethyl-N-propan-2-ylthiophene-3-carboxamide. InChIKey: ODGCLVKBWHXNKT-UHFFFAOYSA-N.
| Molecular formula | C10H15NOS |
|---|---|
| Molecular weight | 197.30 g/mol |
| IUPAC name | 2,5-dimethyl-N-propan-2-ylthiophene-3-carboxamide |
| InChIKey | ODGCLVKBWHXNKT-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(S1)C)C(=O)NC(C)C |
Computed by PubChem (NCBI)