CAS 109134-39-6 is the registry number for 1H,1H,2H,2H-Perfluoropentyltrimethoxysilane. Offered by: Biosynth. Available pack sizes: 1g.
3,3,4,4,5,5,5-heptafluoropentyl(trimethoxy)silane (CAS 109134-39-6) is a chemical compound with the molecular formula C8H13F7O3Si and a molecular weight of 318.26 g/mol. IUPAC name: 3,3,4,4,5,5,5-heptafluoropentyl(trimethoxy)silane. InChIKey: SIUOAIYCRNJMLQ-UHFFFAOYSA-N.
| Molecular formula | C8H13F7O3Si |
|---|---|
| Molecular weight | 318.26 g/mol |
| IUPAC name | 3,3,4,4,5,5,5-heptafluoropentyl(trimethoxy)silane |
| InChIKey | SIUOAIYCRNJMLQ-UHFFFAOYSA-N |
| SMILES | CO[Si](CCC(C(C(F)(F)F)(F)F)(F)F)(OC)OC |
Computed by PubChem (NCBI)