Products 1092120-53-0

CAS 1092120-53-0 is the registry number for 4-Hydroxy-1,1-dimethylpiperidinium Bromide, >95% (HPLC). Offered by: TRC. Available pack sizes: 100mg, 1g.

Structural formula: {0} (CAS {1})

1,1-dimethylpiperidin-1-ium-4-ol bromide (CAS 1092120-53-0) is a chemical compound with the molecular formula C7H16BrNO and a molecular weight of 210.11 g/mol. IUPAC name: 1,1-dimethylpiperidin-1-ium-4-ol bromide. InChIKey: QNNSJHYZYCEGAQ-UHFFFAOYSA-M.

Identity
Molecular formulaC7H16BrNO
Molecular weight210.11 g/mol
IUPAC name1,1-dimethylpiperidin-1-ium-4-ol bromide
InChIKeyQNNSJHYZYCEGAQ-UHFFFAOYSA-M
SMILESC[N+]1(CCC(CC1)O)C.[Br-]

Computed by PubChem (NCBI)