Products 1092278-50-6
CAS 1092278-50-6 appears in our catalog under these names: 4-(1,1-Dimethylethyl)benzenesulfonyl fluoride, 95%, 4-tert-Butylbenzene-1-sulfonyl fluoride, 95%. Offered by: Combi-blocks, Ambeed. Available pack sizes: 10g, 1g, 250mg, 5g.
4-tert-butylbenzenesulfonyl fluoride (CAS 1092278-50-6) is a chemical compound with the molecular formula C10H13FO2S and a molecular weight of 216.27 g/mol. IUPAC name: 4-tert-butylbenzenesulfonyl fluoride. InChIKey: YMGHXAOUCWPSDV-UHFFFAOYSA-N.
| Molecular formula | C10H13FO2S |
|---|---|
| Molecular weight | 216.27 g/mol |
| IUPAC name | 4-tert-butylbenzenesulfonyl fluoride |
| InChIKey | YMGHXAOUCWPSDV-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=CC=C(C=C1)S(=O)(=O)F |
Computed by PubChem (NCBI)