Products 1092284-61-1
CAS 1092284-61-1 is the registry number for 2-(5-Chloro-2-oxobenzo[d]oxazol-3(2H)-yl)acetohydrazide, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
2-(5-chloro-2-oxo-1,3-benzoxazol-3-yl)acetohydrazide (CAS 1092284-61-1) is a chemical compound with the molecular formula C9H8ClN3O3 and a molecular weight of 241.63 g/mol. IUPAC name: 2-(5-chloro-2-oxo-1,3-benzoxazol-3-yl)acetohydrazide. InChIKey: KCAMSUZMDYLJDD-UHFFFAOYSA-N.
| Molecular formula | C9H8ClN3O3 |
|---|---|
| Molecular weight | 241.63 g/mol |
| IUPAC name | 2-(5-chloro-2-oxo-1,3-benzoxazol-3-yl)acetohydrazide |
| InChIKey | KCAMSUZMDYLJDD-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1Cl)N(C(=O)O2)CC(=O)NN |
Computed by PubChem (NCBI)