CAS 1092288-09-9 appears in our catalog under these names: 3-(4-Fluorophenyl)-4-phenyl-1,2-oxazol-5-amine, 95%, 3-(4-Fluorophenyl)-4-phenyl-1,2-oxazol-5-amine. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 50mg, 0,5g.
3-(4-fluorophenyl)-4-phenyl-1,2-oxazol-5-amine (CAS 1092288-09-9) is a chemical compound with the molecular formula C15H11FN2O and a molecular weight of 254.26 g/mol. IUPAC name: 3-(4-fluorophenyl)-4-phenyl-1,2-oxazol-5-amine. InChIKey: XCJRPTVOHSWTQN-UHFFFAOYSA-N.
| Molecular formula | C15H11FN2O |
|---|---|
| Molecular weight | 254.26 g/mol |
| IUPAC name | 3-(4-fluorophenyl)-4-phenyl-1,2-oxazol-5-amine |
| InChIKey | XCJRPTVOHSWTQN-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=C(ON=C2C3=CC=C(C=C3)F)N |
Computed by PubChem (NCBI)