CAS 109229-58-5 is the registry number for Englitazone. Offered by: Hubei YoungXin. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 200mg.
5-[[(2R)-2-benzyl-3,4-dihydro-2H-chromen-6-yl]methyl]-1,3-thiazolidine-2,4-dione (CAS 109229-58-5) is a chemical compound with the molecular formula C20H19NO3S and a molecular weight of 353.4 g/mol. IUPAC name: 5-[[(2R)-2-benzyl-3,4-dihydro-2H-chromen-6-yl]methyl]-1,3-thiazolidine-2,4-dione. InChIKey: MVDXXGIBARMXSA-PYUWXLGESA-N.
| Molecular formula | C20H19NO3S |
|---|---|
| Molecular weight | 353.4 g/mol |
| IUPAC name | 5-[[(2R)-2-benzyl-3,4-dihydro-2H-chromen-6-yl]methyl]-1,3-thiazolidine-2,4-dione |
| InChIKey | MVDXXGIBARMXSA-PYUWXLGESA-N |
| SMILES | C1CC2=C(C=CC(=C2)CC3C(=O)NC(=O)S3)O[C@H]1CC4=CC=CC=C4 |
Computed by PubChem (NCBI)