Products 1092290-02-2
CAS 1092290-02-2 is the registry number for 2,7-Dimethyl-[1,2,4]triazolo[1,5-a]pyridin-5(1H)-one, 95%. Offered by: Ambeed. Available pack sizes: 100mg, 250mg, 1g.
2,7-dimethyl-3H-[1,2,4]triazolo[1,5-a]pyridin-5-one (CAS 1092290-02-2) is a chemical compound with the molecular formula C8H9N3O and a molecular weight of 163.18 g/mol. IUPAC name: 2,7-dimethyl-3H-[1,2,4]triazolo[1,5-a]pyridin-5-one. InChIKey: KLJKVGBIRDVQDZ-UHFFFAOYSA-N.
| Molecular formula | C8H9N3O |
|---|---|
| Molecular weight | 163.18 g/mol |
| IUPAC name | 2,7-dimethyl-3H-[1,2,4]triazolo[1,5-a]pyridin-5-one |
| InChIKey | KLJKVGBIRDVQDZ-UHFFFAOYSA-N |
| SMILES | CC1=CC(=O)N2C(=C1)N=C(N2)C |
Computed by PubChem (NCBI)