Products 1092300-03-2

CAS 1092300-03-2 appears in our catalog under these names: [4-(1-Methyl-1-phenylethyl)phenoxy]acetyl chloride, 95%, (4-(1-Methyl-1-phenylethyl)phenoxy)acetyl chloride, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 250mg, 1g.

Structural formula: {0} (CAS {1})

2-[4-(2-phenylpropan-2-yl)phenoxy]acetyl chloride (CAS 1092300-03-2) is a chemical compound with the molecular formula C17H17ClO2 and a molecular weight of 288.8 g/mol. IUPAC name: 2-[4-(2-phenylpropan-2-yl)phenoxy]acetyl chloride. InChIKey: BSDHAJCIHFXUIR-UHFFFAOYSA-N.

Identity
Molecular formulaC17H17ClO2
Molecular weight288.8 g/mol
IUPAC name2-[4-(2-phenylpropan-2-yl)phenoxy]acetyl chloride
InChIKeyBSDHAJCIHFXUIR-UHFFFAOYSA-N
SMILESCC(C)(C1=CC=CC=C1)C2=CC=C(C=C2)OCC(=O)Cl

Computed by PubChem (NCBI)