CAS 1092346-81-0 appears in our catalog under these names: 2-(4-Ethoxyphenylamino)-4-(3-methyl-4-fluorophenyl)thiazole, 95%, 2-(4-Ethoxyphenylamino)-4-(3-methyl-4-fluorophenyl)thiazole. Offered by: Combi-blocks, Biosynth. Available pack sizes: 100mg, 1000mg, 500mg, 2000mg.
N-(4-ethoxyphenyl)-4-(4-fluoro-3-methylphenyl)-1,3-thiazol-2-amine (CAS 1092346-81-0) is a chemical compound with the molecular formula C18H17FN2OS and a molecular weight of 328.4 g/mol. IUPAC name: N-(4-ethoxyphenyl)-4-(4-fluoro-3-methylphenyl)-1,3-thiazol-2-amine. InChIKey: VHENMACGAMSIQR-UHFFFAOYSA-N.
| Molecular formula | C18H17FN2OS |
|---|---|
| Molecular weight | 328.4 g/mol |
| IUPAC name | N-(4-ethoxyphenyl)-4-(4-fluoro-3-methylphenyl)-1,3-thiazol-2-amine |
| InChIKey | VHENMACGAMSIQR-UHFFFAOYSA-N |
| SMILES | CCOC1=CC=C(C=C1)NC2=NC(=CS2)C3=CC(=C(C=C3)F)C |
Computed by PubChem (NCBI)