CAS 1092351-35-3 is the registry number for 8-Chloro-6-nitro-4-oxo-1,4-dihydroquinoline-3-carbonitrile, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
8-chloro-6-nitro-4-oxo-1H-quinoline-3-carbonitrile (CAS 1092351-35-3) is a chemical compound with the molecular formula C10H4ClN3O3 and a molecular weight of 249.61 g/mol. IUPAC name: 8-chloro-6-nitro-4-oxo-1H-quinoline-3-carbonitrile. InChIKey: RPISMGBJCPUIMP-UHFFFAOYSA-N.
| Molecular formula | C10H4ClN3O3 |
|---|---|
| Molecular weight | 249.61 g/mol |
| IUPAC name | 8-chloro-6-nitro-4-oxo-1H-quinoline-3-carbonitrile |
| InChIKey | RPISMGBJCPUIMP-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C2=C1C(=O)C(=CN2)C#N)Cl)[N+](=O)[O-] |
Computed by PubChem (NCBI)