Products 1092352-03-8
CAS 1092352-03-8 appears in our catalog under these names: 1H-Indole-2-ethanol, 5-chloro-2,3-dihydro-, 95%, 1H-indole-2-ethanol, 5-chloro-2,3-dihydro-, 96%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 1g, 5g.
2-(5-chloro-2,3-dihydro-1H-indol-2-yl)ethanol (CAS 1092352-03-8) is a chemical compound with the molecular formula C10H12ClNO and a molecular weight of 197.66 g/mol. IUPAC name: 2-(5-chloro-2,3-dihydro-1H-indol-2-yl)ethanol. InChIKey: WUOFDJWIOOMZML-UHFFFAOYSA-N.
| Molecular formula | C10H12ClNO |
|---|---|
| Molecular weight | 197.66 g/mol |
| IUPAC name | 2-(5-chloro-2,3-dihydro-1H-indol-2-yl)ethanol |
| InChIKey | WUOFDJWIOOMZML-UHFFFAOYSA-N |
| SMILES | C1C(NC2=C1C=C(C=C2)Cl)CCO |
Computed by PubChem (NCBI)