CAS 1092352-99-2 is the registry number for 8-Chloro Anagrelide. Offered by: Chemat Brand, Biosynth. Available pack sizes: on request, 2mg, 1mg, 5mg, 25mg, 10mg.
6,7,8-trichloro-3,5-dihydro-1H-imidazo[2,1-b]quinazolin-2-one (CAS 1092352-99-2) is a chemical compound with the molecular formula C10H6Cl3N3O and a molecular weight of 290.5 g/mol. IUPAC name: 6,7,8-trichloro-3,5-dihydro-1H-imidazo[2,1-b]quinazolin-2-one. InChIKey: QCMDDIIKBFVZSY-UHFFFAOYSA-N.
| Molecular formula | C10H6Cl3N3O |
|---|---|
| Molecular weight | 290.5 g/mol |
| IUPAC name | 6,7,8-trichloro-3,5-dihydro-1H-imidazo[2,1-b]quinazolin-2-one |
| InChIKey | QCMDDIIKBFVZSY-UHFFFAOYSA-N |
| SMILES | C1C2=C(C(=C(C=C2N=C3N1CC(=O)N3)Cl)Cl)Cl |
Computed by PubChem (NCBI)