CAS 1092366-92-1 is the registry number for Evocalcet Impurity 5. Offered by: Chemat Brand. Available pack sizes: on request.
Tert-butyl (3R)-3-(2-nitrophenyl)sulfonyloxypyrrolidine-1-carboxylate (CAS 1092366-92-1) is a chemical compound with the molecular formula C15H20N2O7S and a molecular weight of 372.4 g/mol. IUPAC name: tert-butyl (3R)-3-(2-nitrophenyl)sulfonyloxypyrrolidine-1-carboxylate. InChIKey: YHYDUNGSSDQUFG-LLVKDONJSA-N.
| Molecular formula | C15H20N2O7S |
|---|---|
| Molecular weight | 372.4 g/mol |
| IUPAC name | tert-butyl (3R)-3-(2-nitrophenyl)sulfonyloxypyrrolidine-1-carboxylate |
| InChIKey | YHYDUNGSSDQUFG-LLVKDONJSA-N |
| SMILES | CC(C)(C)OC(=O)N1CC[C@H](C1)OS(=O)(=O)C2=CC=CC=C2[N+](=O)[O-] |
Computed by PubChem (NCBI)