Products 1092394-26-7
CAS 1092394-26-7 is the registry number for tert-butyl N-(2-fluoro-5-hydroxyphenyl)carbamate, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g.
Tert-butyl N-(2-fluoro-5-hydroxyphenyl)carbamate (CAS 1092394-26-7) is a chemical compound with the molecular formula C11H14FNO3 and a molecular weight of 227.23 g/mol. IUPAC name: tert-butyl N-(2-fluoro-5-hydroxyphenyl)carbamate. InChIKey: XFWNAVKWCCUQAL-UHFFFAOYSA-N.
| Molecular formula | C11H14FNO3 |
|---|---|
| Molecular weight | 227.23 g/mol |
| IUPAC name | tert-butyl N-(2-fluoro-5-hydroxyphenyl)carbamate |
| InChIKey | XFWNAVKWCCUQAL-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NC1=C(C=CC(=C1)O)F |
Computed by PubChem (NCBI)