CAS 1092484-56-4 appears in our catalog under these names: Fenofibrate-d6, Fenofibrate-d6, >95% (HPLC), Fenofibrate-d6 (dimethyl-d6), 99 atom % D, min 98% Chemical Purity, Fenofibrate–d6, D6-Fenofibrate, Concentration: 100 µg/ml Solvent: Acetonitrile. Offered by: Chemat Brand, TRC, CDN, GLPBio, HPC Standards. Available pack sizes: on request, 10mg, 1mg, 0,01g, 0,005g, 5mg, 500μg, 1x1ml.
Propan-2-yl 2-[4-(4-chlorobenzoyl)phenoxy]-3,3,3-trideuterio-2-(trideuteriomethyl)propanoate (CAS 1092484-56-4) is a chemical compound with the molecular formula C20H21ClO4 and a molecular weight of 366.9 g/mol. IUPAC name: propan-2-yl 2-[4-(4-chlorobenzoyl)phenoxy]-3,3,3-trideuterio-2-(trideuteriomethyl)propanoate. InChIKey: YMTINGFKWWXKFG-LIJFRPJRSA-N.
| Molecular formula | C20H21ClO4 |
|---|---|
| Molecular weight | 366.9 g/mol |
| IUPAC name | propan-2-yl 2-[4-(4-chlorobenzoyl)phenoxy]-3,3,3-trideuterio-2-(trideuteriomethyl)propanoate |
| InChIKey | YMTINGFKWWXKFG-LIJFRPJRSA-N |
| SMILES | [2H]C([2H])([2H])C(C(=O)OC(C)C)(C([2H])([2H])[2H])OC1=CC=C(C=C1)C(=O)C2=CC=C(C=C2)Cl |
Computed by PubChem (NCBI)