CAS 1092542-31-8 appears in our catalog under these names: 2-Bromo-6-(trimethylsilyl)phenyl triflate, 95%, 2-BROMO-6-(TRIMETHYLSILYL)PHENYL TRIFLAT. Offered by: Combi-blocks, Sigma-Aldrich. Available pack sizes: 1g, 250mg.
(2-bromo-6-trimethylsilylphenyl) trifluoromethanesulfonate (CAS 1092542-31-8) is a chemical compound with the molecular formula C10H12BrF3O3SSi and a molecular weight of 377.25 g/mol. IUPAC name: (2-bromo-6-trimethylsilylphenyl) trifluoromethanesulfonate. InChIKey: ZNKAHJCGEPVEBA-UHFFFAOYSA-N.
| Molecular formula | C10H12BrF3O3SSi |
|---|---|
| Molecular weight | 377.25 g/mol |
| IUPAC name | (2-bromo-6-trimethylsilylphenyl) trifluoromethanesulfonate |
| InChIKey | ZNKAHJCGEPVEBA-UHFFFAOYSA-N |
| SMILES | C[Si](C)(C)C1=C(C(=CC=C1)Br)OS(=O)(=O)C(F)(F)F |
Computed by PubChem (NCBI)