CAS 1092580-97-6 is the registry number for 2-Amino-5-bromo-n,n-dimethylnicotinamide, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
2-amino-5-bromo-N,N-dimethylpyridine-3-carboxamide (CAS 1092580-97-6) is a chemical compound with the molecular formula C8H10BrN3O and a molecular weight of 244.09 g/mol. IUPAC name: 2-amino-5-bromo-N,N-dimethylpyridine-3-carboxamide. InChIKey: DBEMSDGWYOHTIH-UHFFFAOYSA-N.
| Molecular formula | C8H10BrN3O |
|---|---|
| Molecular weight | 244.09 g/mol |
| IUPAC name | 2-amino-5-bromo-N,N-dimethylpyridine-3-carboxamide |
| InChIKey | DBEMSDGWYOHTIH-UHFFFAOYSA-N |
| SMILES | CN(C)C(=O)C1=C(N=CC(=C1)Br)N |
Computed by PubChem (NCBI)