CAS 1092790-23-2 is the registry number for {Pyrido[2,3-b]pyrazin-7-yl}boronic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
Pyrido[2,3-b]pyrazin-7-ylboronic acid (CAS 1092790-23-2) is a chemical compound with the molecular formula C7H6BN3O2 and a molecular weight of 174.95 g/mol. IUPAC name: pyrido[2,3-b]pyrazin-7-ylboronic acid. InChIKey: ALHRJBIHMIAJAA-UHFFFAOYSA-N.
| Molecular formula | C7H6BN3O2 |
|---|---|
| Molecular weight | 174.95 g/mol |
| IUPAC name | pyrido[2,3-b]pyrazin-7-ylboronic acid |
| InChIKey | ALHRJBIHMIAJAA-UHFFFAOYSA-N |
| SMILES | B(C1=CC2=NC=CN=C2N=C1)(O)O |
Computed by PubChem (NCBI)