CAS 1092794-94-9 appears in our catalog under these names: 1,1,2-Trimethylisoindolin-5-amine 95%, 1,1,2-Trimethylisoindolin-5-amine, 95%, 95%. Offered by: Ambeed, Chemat. Available pack sizes: 50mg, 100mg, 250mg, 1g.
1,1,2-trimethyl-3H-isoindol-5-amine (CAS 1092794-94-9) is a chemical compound with the molecular formula C11H16N2 and a molecular weight of 176.26 g/mol. IUPAC name: 1,1,2-trimethyl-3H-isoindol-5-amine. InChIKey: QAWIGFGJXOCTRI-UHFFFAOYSA-N.
| Molecular formula | C11H16N2 |
|---|---|
| Molecular weight | 176.26 g/mol |
| IUPAC name | 1,1,2-trimethyl-3H-isoindol-5-amine |
| InChIKey | QAWIGFGJXOCTRI-UHFFFAOYSA-N |
| SMILES | CC1(C2=C(CN1C)C=C(C=C2)N)C |
Computed by PubChem (NCBI)