CAS 1092844-00-2 appears in our catalog under these names: Rosuvastatin Impurity 155, Rosuvastatin Impurity 96. Offered by: Chemat Brand. Available pack sizes: on request.
N-[5-cyano-4-(4-fluorophenyl)-6-propan-2-ylpyrimidin-2-yl]-N-methylmethanesulfonamide (CAS 1092844-00-2) is a chemical compound with the molecular formula C16H17FN4O2S and a molecular weight of 348.4 g/mol. IUPAC name: N-[5-cyano-4-(4-fluorophenyl)-6-propan-2-ylpyrimidin-2-yl]-N-methylmethanesulfonamide. InChIKey: FBPIJENARXXHQH-UHFFFAOYSA-N.
| Molecular formula | C16H17FN4O2S |
|---|---|
| Molecular weight | 348.4 g/mol |
| IUPAC name | N-[5-cyano-4-(4-fluorophenyl)-6-propan-2-ylpyrimidin-2-yl]-N-methylmethanesulfonamide |
| InChIKey | FBPIJENARXXHQH-UHFFFAOYSA-N |
| SMILES | CC(C)C1=NC(=NC(=C1C#N)C2=CC=C(C=C2)F)N(C)S(=O)(=O)C |
Computed by PubChem (NCBI)