CAS 1092851-70-1 appears in our catalog under these names: HO-1-in-1 hydrochloride, Heme Oxygenase-1-IN-1 hydrochloride, Heme Oxygenase-1-IN-1 (hydrochloride), Heme Oxygenase-1-IN-1 HCl, 99+%, Heme Oxygenase-1-IN-1 (hydrochloride), 99.03%. Offered by: Biosynth, TargetMol, Chemat, AmBeed, MedChemExpress. Available pack sizes: 25mg, 50mg, 100mg, 5mg, 10mg, 100 mg, 5 mg, 10mM/1mL.
1-[4-(4-bromophenyl)butyl]imidazole;hydrochloride (CAS 1092851-70-1) is a chemical compound with the molecular formula C13H16BrClN2 and a molecular weight of 315.63 g/mol. IUPAC name: 1-[4-(4-bromophenyl)butyl]imidazole;hydrochloride. InChIKey: IUTCFFFBKPGSJF-UHFFFAOYSA-N.
| Molecular formula | C13H16BrClN2 |
|---|---|
| Molecular weight | 315.63 g/mol |
| IUPAC name | 1-[4-(4-bromophenyl)butyl]imidazole;hydrochloride |
| InChIKey | IUTCFFFBKPGSJF-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1CCCCN2C=CN=C2)Br.Cl |
Computed by PubChem (NCBI)