CAS 1092938-89-0 is the registry number for 4-Methoxy-1-cyclohexenyl Trifluoromethanesulfonate. Offered by: TRC. Available pack sizes: 500mg.
(4-methoxycyclohexen-1-yl) trifluoromethanesulfonate (CAS 1092938-89-0) is a chemical compound with the molecular formula C8H11F3O4S and a molecular weight of 260.23 g/mol. IUPAC name: (4-methoxycyclohexen-1-yl) trifluoromethanesulfonate. InChIKey: SQXVHXHZNBAHFB-UHFFFAOYSA-N.
| Molecular formula | C8H11F3O4S |
|---|---|
| Molecular weight | 260.23 g/mol |
| IUPAC name | (4-methoxycyclohexen-1-yl) trifluoromethanesulfonate |
| InChIKey | SQXVHXHZNBAHFB-UHFFFAOYSA-N |
| SMILES | COC1CCC(=CC1)OS(=O)(=O)C(F)(F)F |
Computed by PubChem (NCBI)